![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | untitled3.jpg | 2011-05-13 00:13 | 309K | |
![[ ]](/icons/unknown.gif) | Thumbs.db | 2014-12-22 20:56 | 299K | |
| untitled4.jpg | 2011-05-13 00:12 | 223K | |
| untitled2.jpg | 2011-05-13 00:13 | 221K | |
| untitled1.jpg | 2011-05-13 00:13 | 203K | |
| untitled12.jpg | 2011-05-13 00:10 | 189K | |
| untitled15.jpg | 2011-05-13 00:09 | 187K | |
| untitled8.jpg | 2011-05-13 00:11 | 179K | |
| untitled13.jpg | 2011-05-13 00:09 | 169K | |
| untitled11.jpg | 2011-05-13 00:10 | 166K | |
| untitled7.jpg | 2011-05-13 00:11 | 164K | |
| untitled16.jpg | 2011-05-13 00:08 | 152K | |
![[TXT]](/icons/text.gif) | Defined_Terms_YELP.htm | 2024-09-19 00:12 | 148K | |
| Defined Terms.htm | 2024-09-19 00:02 | 148K | |
| untitled9.jpg | 2011-05-13 00:11 | 145K | |
| untitled5.jpg | 2011-05-13 00:12 | 145K | |
| untitled10.jpg | 2011-05-13 00:10 | 132K | |
| untitled14.jpg | 2011-05-13 00:09 | 123K | |
| gary_matt.jpg | 2011-03-29 16:24 | 108K | |
| untitled6.jpg | 2011-05-13 00:12 | 102K | |
| ReferencesHealthAgenciesHealthProgramAndWebsites.htm | 2024-09-19 00:12 | 73K | |
| Adreneline.htm | 2020-09-25 23:43 | 69K | |
| Holistic_Health.htm | 2024-09-19 00:12 | 69K | |
| Primary_Research_Programme.htm | 2024-09-19 00:12 | 66K | |
| 25Vol_from_Disadvantage,Marginalise_Abled_Disable.htm | 2024-09-19 00:12 | 65K | |
| swot_analysis.htm | 2024-09-19 00:12 | 64K | |
| TNPHRP_Budget_Costs.htm | 2024-09-19 00:12 | 64K | |
| Peppercorn_Fee.htm | 2024-09-19 00:12 | 59K | |
| Endorphins.htm | 2024-09-19 00:12 | 59K | |
| mercury_pic1.gif | 2011-03-29 16:24 | 59K | |
| Recollections_of_the_13_members_of_Team_NOVA.htm | 2024-09-19 00:12 | 57K | |
| Youthful_Exuberance_Lifestyle_Programme.htm | 2024-09-19 00:12 | 55K | |
| Intellectual_Property.htm | 2024-09-19 00:12 | 54K | |
| FourBenefitsFor12ProposedPrivateEquityHolders.htm | 2024-09-19 00:12 | 54K | |
| PPP1.htm | 2024-09-19 00:12 | 53K | |
| Pioneer_Fit_Old_Farts.htm | 2024-09-19 00:12 | 52K | |
| Arthritis.htm | 2024-09-19 00:12 | 51K | |
| Measure Up campaign.htm | 2024-09-19 00:12 | 48K | |
| 50_50_Funding_Model.htm | 2024-09-19 00:12 | 45K | |
| ContentOfHillyRidesChallenge.htm | 2024-09-19 00:12 | 43K | |
| Twelve_low_cost_propagation_initiatives.htm | 2024-09-19 00:12 | 43K | |
| Milestones_Timetable.htm | 2024-09-19 00:12 | 41K | |
| Respective_Products_Available.htm | 2024-09-19 00:12 | 40K | |
| Sculpture.htm | 2024-09-19 00:12 | 40K | |
| Propagation Forecasts.htm | 2024-09-19 00:12 | 39K | |
| Philanthropy.htm | 2024-09-19 00:12 | 38K | |
| FiveBasic�StagesOfChange�.htm | 2024-09-19 00:12 | 38K | |
| Golden_Gurus.htm | 2024-09-19 00:12 | 37K | |
| Precedent_For_The_Hypothesis.htm | 2024-09-19 00:12 | 37K | |
| ather_lowres.gif | 2008-05-28 07:44 | 37K | |
| Beneficial_Effects.htm | 2024-09-19 00:12 | 36K | |
| Business_Plan_Developer.htm | 2024-09-19 00:12 | 35K | |
| 9RigorousRecreationalExerciseActivities.htm | 2024-09-19 00:12 | 35K | |
| OverdoseEIDs.htm | 2024-09-19 00:12 | 35K | |
| 4P'sOfProjectDevelopment.htm | 2024-09-19 01:37 | 34K | |
| RTVPromotionOnDVDtoCliniciansAtOutsetOfPilot.htm | 2024-09-19 00:12 | 34K | |
| Annual_Endurance_Sporting_Event.htm | 2024-09-19 00:12 | 34K | |
| MarketingOpportunitiesTo PromoteYELP.htm | 2024-09-19 00:12 | 34K | |
| Hilly Rides Challenge.htm | 2024-09-19 00:12 | 33K | |
| Motivational_Incentive_of_RTV.htm | 2024-09-19 00:12 | 33K | |
| 6ModerateRecreationalExerciseActivities.htm | 2024-09-19 00:12 | 33K | |
| Five_Business_Plans.htm | 2024-09-19 00:12 | 33K | |
| CommunityOrganModelForSocial&EconomicChange.htm | 2024-09-19 00:12 | 32K | |
| Critics_of_Economic_Materialism.htm | 2024-09-19 00:12 | 32K | |
| Biopsychosocial_Behaviour_Model.htm | 2024-09-19 00:12 | 32K | |
| Community_Organizing_Group.htm | 2024-09-19 00:12 | 31K | |
| Fifteen_Problems.htm | 2024-09-19 00:12 | 30K | |
| KPI-YELP_SPV's_Eight_KPIs.htm | 2024-09-19 00:12 | 30K | |
| Fifteen_Benefits_Of_Materially_Altered_Lifestyle.htm | 2024-09-19 00:12 | 29K | |
| Indigenous_Australians .htm | 2024-09-19 00:12 | 28K | |
| PerformsNineDuties&ObligationsOfSupervision.htm | 2024-09-19 00:12 | 28K | |
| Carbon_Footprint.htm | 2024-09-19 00:12 | 28K | |
| Local_Community_Common_Bond_Support_Group.htm | 2024-09-19 00:12 | 27K | |
| HeadConsultantsConditions PrecedentToPilot.htm | 2024-09-19 00:12 | 26K | |
| Local Community Healthy Lifestyle.htm | 2024-09-19 00:12 | 26K | |
| Swap_It,_Don't_Stop_It .htm | 2024-09-19 00:12 | 26K | |
| Attracting_Private_Sector_Funding.htm | 2024-09-19 00:12 | 26K | |
| Secondary_Purpose.htm | 2024-09-19 00:12 | 26K | |
| Existing_Human_Resources.htm | 2024-09-19 00:12 | 26K | |
| ExistingRec&CompetitivelExerciseInfrastructure.htm | 2024-09-19 00:12 | 25K | |
| CompilationOf12PrivateSectorEquityHolders.htm | 2024-09-19 00:12 | 25K | |
| e-Learning and e-Research Techniques.htm | 2024-09-19 00:12 | 25K | |
| EquityHolder'sInputForABC'sHillyRidesChallenge.htm | 2024-09-19 00:12 | 24K | |
| Capture_Complimentary_Synergies.htm | 2024-09-19 00:12 | 24K | |
| Recreational_Exercise_Consultant.htm | 2024-09-19 00:12 | 24K | |
| RecreationalExerciseGroup.htm | 2024-09-19 00:12 | 24K | |
| Accredited_Participant.htm | 2024-09-19 00:12 | 24K | |
| Cognitive_Behaviour_Therapy.htm | 2024-09-19 00:12 | 23K | |
| Eleven Sports Admin Attributes.htm | 2024-09-19 00:12 | 23K | |
| Marathon Challenge.htm | 2024-09-19 00:12 | 23K | |
| Product.htm | 2024-09-19 00:12 | 23K | |
| defined_Terms-YELP_Jargon.htm | 2024-09-19 00:12 | 23K | |
| 10_Months_Tenure_Primary_Research_Program.htm | 2024-09-19 00:12 | 23K | |
| Ten_Processes_Of_Change.htm | 2024-09-19 00:12 | 23K | |
| Propagate.htm | 2024-09-19 00:12 | 22K | |
| YouthfulExuberanceLifestyleProgrammeWebsite.htm | 2024-09-19 00:12 | 22K | |
| Four Public Sector Equity Holders.htm | 2024-09-19 00:12 | 22K | |
| Hypothesis.htm | 2024-09-19 00:12 | 22K | |
| Negligent_Lifestyle_Behaviour.htm | 2024-09-19 00:12 | 22K | |
| 12PrivateEquityHolders.htm | 2024-09-19 00:12 | 22K | |
| Five_FOF_Qualities.htm | 2024-09-19 00:12 | 21K | |
| Mass_Media_Campaigns.htm | 2024-09-19 00:12 | 21K | |
| Pilot.htm | 2024-09-19 00:12 | 21K | |
| Gatekeepers.htm | 2024-09-19 00:12 | 21K | |
| DefinedTermsTwoNatPreventHealthResPrograms.htm | 2024-09-19 00:12 | 21K | |
| PPP.htm | 2024-09-19 00:12 | 21K | |
| BusinessPlansTwoNatPrevHealthResearchPrograms.htm | 2024-09-19 00:12 | 21K | |
| Gross REC Remuneration.htm | 2024-09-19 00:12 | 21K | |
| Encouraging_Optimum,_Uniform_Delivery_Model.htm | 2024-09-19 00:12 | 21K | |
| Bottom-Up_Programme-Justified_Driver.htm | 2024-09-19 00:12 | 21K | |
| CompeteForMarketShare.htm | 2024-09-19 00:12 | 20K | |
| Pilot_Delivery_Team.htm | 2024-09-19 00:12 | 20K | |
| TwoNatPreventativeHealthResearchPrograms.htm | 2024-09-19 00:12 | 20K | |
| Challenges_or_Challenging.htm | 2024-09-19 00:12 | 20K | |
| YELP_SPV.htm | 2024-09-19 00:12 | 20K | |
| TwoLegendaryEnduranceCyclingChallenges.htm | 2024-09-19 00:12 | 20K | |
| YELP's_No_Media_Advertising_Policy.htm | 2024-09-19 00:12 | 20K | |
| TwoMajor&TwoMinorPublicEquityHolders.htm | 2024-09-19 00:12 | 19K | |
| Participant_Personal_Profile_Page.htm | 2024-09-19 00:12 | 19K | |
| Hilly_Rides_Challenge_RTV_Promotion.htm | 2024-09-19 00:12 | 19K | |
| FirstPurposeOfTheResearchProgramme.htm | 2024-09-19 00:12 | 19K | |
| Obesity.htm | 2024-09-19 00:12 | 19K | |
| Accredited_Coaching_Certificate.htm | 2024-09-19 00:12 | 19K | |
| Five_SPVs.htm | 2024-09-19 00:12 | 19K | |
| 21�_Months_Tenure_Of_Pilot.htm | 2024-09-19 00:12 | 18K | |
| ComDrivenHealthyExerciseLifestyleProgram.htm | 2020-09-25 23:43 | 18K | |
| Outsource.htm | 2024-09-19 00:12 | 18K | |
| Interdependent.htm | 2024-09-19 00:12 | 18K | |
| Exceptional Community Contribution.htm | 2024-09-19 00:12 | 18K | |
| SecondBasicComponentOfCognitiveBehaviourTherapy.htm | 2024-09-19 00:12 | 18K | |
| 20_Months_Tenure_Of_Pilot.htm | 2024-09-19 00:12 | 18K | |
| HMO.htm | 2024-09-19 00:12 | 18K | |
| Primary_Purpose.htm | 2024-09-19 00:12 | 18K | |
| Various_Parties.htm | 2024-09-19 00:12 | 17K | |
| RTV Promotion.htm | 2024-09-19 00:12 | 17K | |
| Purpose Of Pilot.htm | 2024-09-19 00:12 | 17K | |
| Sporting�Clubs.htm | 2024-09-19 00:12 | 17K | |
| Beyond_Boundaries.htm | 2024-09-19 00:12 | 17K | |
| Harness_Private_Sector_Infrastructure_&_PPP_Skills.htm | 2024-09-19 00:12 | 17K | |
| Industry�Carbon Taxes.htm | 2024-09-19 00:12 | 17K | |
| FW Ultimate boy toy . . ..htm | 2024-09-19 00:12 | 17K | |
| Wellbeing.htm | 2024-09-19 00:12 | 17K | |
| Depression.htm | 2024-09-19 00:12 | 17K | |
| Exercise.htm | 2024-09-19 00:12 | 17K | |
| SecondPurposeOfTheResearchProgramme.htm | 2024-09-19 00:12 | 17K | |
| Choir�of�Hard�Knocks.htm | 2024-09-19 00:12 | 17K | |
| Motivational Interviewing Techniques.htm | 2024-09-19 00:12 | 16K | |
| AnnualPresentationAwardsDinner.htm | 2024-09-19 00:12 | 16K | |
| EconomicMaterialism-car_boat.htm | 2024-09-19 00:12 | 16K | |
| Optimum,_Uniform_Delivery_Model.htm | 2024-09-19 00:12 | 16K | |
| Research_Programme_Team.htm | 2024-09-19 00:12 | 16K | |
| TwoMajorPublicEquityHolder.htm | 2024-09-19 00:12 | 16K | |
| 60_PrivateEquityHolders.htm | 2024-09-19 00:12 | 16K | |
| IPCC.htm | 2024-09-19 00:12 | 16K | |
| Thirteen_steps_to_complete_a_greenfield.htm | 2024-09-19 00:12 | 16K | |
| Osteoarthritis.htm | 2024-09-19 00:12 | 16K | |
| Preventive Health.htm | 2024-09-19 00:12 | 16K | |
| Joint_Venture.htm | 2024-09-19 00:12 | 16K | |
| Bushwalking.htm | 2024-09-19 00:12 | 16K | |
| Sedentary_Lifestyle.htm | 2024-09-19 00:12 | 16K | |
| Recognises Winners.htm | 2024-09-19 00:12 | 16K | |
| Benefits_To_Each_Minor_Public_Equity_Holder.htm | 2024-09-19 00:12 | 16K | |
| FirstNationalPreventHealthResearchProgram.htm | 2024-02-01 23:26 | 16K | |
| TwoMinorPublicEquityHolder.htm | 2024-09-19 00:12 | 16K | |
| Back_Pain.htm | 2024-09-19 00:12 | 15K | |
| Healthy Diet.htm | 2024-09-19 00:12 | 15K | |
| Benefits_To_Each_Major_Public_Equity_Holder.htm | 2024-09-19 00:12 | 15K | |
| Gross Head Consultant Remuneration.htm | 2024-09-19 00:12 | 15K | |
| Volunteers.htm | 2024-09-19 00:12 | 15K | |
| RigorousRecreationalExerciseActivity.htm | 2024-09-19 00:12 | 15K | |
| Abled_Participant_Assistant.htm | 2024-09-19 00:12 | 15K | |
| Hub.htm | 2024-09-19 00:12 | 15K | |
| Ocean_Swimming.htm | 2024-09-19 00:12 | 15K | |
| R&DTimeBudgetCostsToPropagateThreeBusinessPlans.htm | 2024-09-19 00:12 | 15K | |
| TwoSeasonedEnduranceRoadCyclists.htm | 2024-09-19 00:12 | 15K | |
| Hilly_Rides_Challenge_Equipment_Kit.htm | 2024-09-19 00:12 | 15K | |
| Lifestyle�Behaviour.htm | 2024-09-19 00:12 | 15K | |
| Disabled.htm | 2024-09-19 00:12 | 15K | |
| Take_Charge_Of.htm | 2024-09-19 00:12 | 15K | |
| Personal_Eco_Profile.htm | 2024-09-19 00:12 | 14K | |
| Recreational_Road_Cycling.htm | 2024-09-19 00:12 | 14K | |
| Youthful_Exuberance Theme.htm | 2024-09-19 00:12 | 14K | |
| Regulatory_Control.htm | 2024-09-19 00:12 | 14K | |
| Training�Procedures.htm | 2024-09-19 00:12 | 14K | |
| Complimentary_Low_Cost_Initiatives.htm | 2024-09-19 00:12 | 14K | |
| Equity Contributions.htm | 2024-09-19 00:12 | 14K | |
| Media&NetworkingCampaign.htm | 2024-09-19 00:12 | 14K | |
| Climate_Change.htm | 2024-09-19 00:12 | 14K | |
| Fit_Old_Farts.htm | 2024-09-19 00:12 | 14K | |
| Materially Alter Lifestyle.htm | 2024-09-19 00:12 | 14K | |
| Exercise_Induced_Asthma.htm | 2024-09-19 00:12 | 14K | |
| Road_And_Track_Cycle_Racing.htm | 2024-09-19 00:12 | 14K | |
| Sporting�Participant.htm | 2024-09-19 00:12 | 14K | |
| LocalDistrictRigorousRecreationalExerciseGroup.htm | 2024-09-19 00:12 | 14K | |
| Pilot_Sample.htm | 2024-09-19 00:12 | 14K | |
| 8lawsofPhysicalHealth.htm | 2024-09-19 00:12 | 14K | |
| Sporting�Teams.htm | 2024-09-19 00:12 | 14K | |
| Commoditise.htm | 2024-09-19 00:12 | 14K | |
| RecreationalExerciseActivityIsFun&Addictive.htm | 2024-09-19 00:12 | 14K | |
| Test_The_Hypothesis.htm | 2024-09-19 00:12 | 14K | |
| Coronary_Artery_Disease.htm | 2024-09-19 00:12 | 14K | |
| Lawn_Bowls.htm | 2024-09-19 00:12 | 14K | |
| RequestForAssistanceFromADisabledInterestedAdult.htm | 2024-09-19 00:12 | 14K | |
| RET (Tourism).htm | 2024-09-19 00:12 | 14K | |
| Mountain Biking.htm | 2024-09-19 00:12 | 14K | |
| Interested Parties.htm | 2024-09-19 00:12 | 13K | |
| 16 Equity Holders.htm | 2024-09-19 00:12 | 13K | |
| Research_Programme_Brief.htm | 2024-09-19 00:12 | 13K | |
| assistance_procedures_means_proc.htm | 2024-09-19 00:12 | 13K | |
| Final Three Stages.htm | 2024-09-19 00:12 | 13K | |
| Chronic_Pain.htm | 2024-09-19 00:12 | 13K | |
| Diabetes_Mellitus.htm | 2024-09-19 00:12 | 13K | |
| Traditional_Role_Of_Democratic_Government.htm | 2024-09-19 00:12 | 13K | |
| CulturalSocialChangeLessReliantOnEconMaterialism.htm | 2024-09-19 00:12 | 13K | |
| Three_Purposes_Of_Pilot.htm | 2024-09-19 00:12 | 13K | |
| Osteoporosis.htm | 2024-09-19 00:12 | 13K | |
| Predatory_Marketing.htm | 2024-09-19 00:12 | 13K | |
| Carbon_Reducing_Lifestyle_Behaviours.htm | 2024-09-19 00:12 | 13K | |
| Four_Risk_Management_Articles.htm | 2024-09-19 00:12 | 13K | |
| Renewable_Energy.htm | 2024-09-19 00:12 | 13K | |
| type_2_diabetes.htm | 2024-09-19 00:12 | 13K | |
| Participant.htm | 2024-09-19 00:12 | 13K | |
| Asthma.htm | 2024-09-19 00:12 | 13K | |
| SevenLifestyleBehaviourInfluences.htm | 2024-09-19 00:12 | 13K | |
| AddresseesFourProposedPublicSectorEquityHolders.htm | 2024-09-19 00:12 | 13K | |
| two_research_programme_progress.htm | 2024-09-19 00:12 | 13K | |
| Social_Dancing.htm | 2024-09-19 00:12 | 13K | |
| SportinglActivityProvider.htm | 2024-09-19 00:12 | 13K | |
| Health_&_Fitness_Centres.htm | 2024-09-19 00:12 | 13K | |
| Pilates.htm | 2024-09-19 00:12 | 13K | |
| Mild_Depression.htm | 2024-09-19 00:12 | 13K | |
| multiple_choice_test.htm | 2024-09-19 00:12 | 13K | |
| OneYearAfterResearchProgramProgressReport.htm | 2024-09-19 00:12 | 13K | |
| Other_Four_YELP_Business_Plans.htm | 2024-09-19 00:12 | 13K | |
| Petrol�Heads.htm | 2024-09-19 00:12 | 13K | |
| Nova.htm | 2024-09-19 00:12 | 13K | |
| Fossil Fuels.htm | 2024-09-19 00:12 | 13K | |
| clip_image001.gif | 2007-12-27 00:33 | 13K | |
| Project_Development_Expertise.htm | 2024-09-19 00:12 | 13K | |
| Lifestyle_Defined_Terms.htm | 2024-09-19 00:12 | 13K | |
| Moderate Recreational Exercise Activity.htm | 2024-09-19 00:12 | 13K | |
| Dementia.htm | 2024-09-19 00:12 | 13K | |
| National Website(s).htm | 2024-09-19 00:12 | 13K | |
| Future_Funding_Models_For_Prevention.htm | 2024-09-19 00:12 | 13K | |
| Change_Social_Values,_Changing_Social_Values.htm | 2024-09-19 00:12 | 12K | |
| Top-Down_Government-Fit_Driver.htm | 2024-09-19 00:12 | 12K | |
| Offer to Assist a Disabled Adult Form.htm | 2024-09-19 00:12 | 12K | |
| Project Life.htm | 2024-09-19 00:12 | 12K | |
| Corporate_Philanthropy.htm | 2024-09-19 00:12 | 12K | |
| Social_Democratic_Government.htm | 2024-09-19 00:12 | 12K | |
| Australia�s_Biggest_Employers .htm | 2024-09-19 00:12 | 12K | |
| YELP Disabled Equipment Fund.htm | 2024-09-19 00:12 | 12K | |
| Senior_Business_Executives.htm | 2024-09-19 00:12 | 12K | |
| Health Assessment Appointment.htm | 2024-09-19 00:12 | 12K | |
| Recreational Drug Use.htm | 2024-09-19 00:12 | 12K | |
| AverageAustralian'sCurrentCarbonFootprint.htm | 2024-09-19 00:12 | 12K | |
| Sociable and Stringent Measures.htm | 2024-09-19 00:12 | 12K | |
| Yoga.htm | 2024-09-19 00:12 | 12K | |
| Colon_and_Breast_cancer.htm | 2024-09-19 00:12 | 12K | |
| Venue_For_the_Research_Programme.htm | 2024-09-19 00:12 | 12K | |
| Climate Change Agencies.htm | 2024-09-19 00:12 | 12K | |
| Executive Health Management.htm | 2024-09-19 00:12 | 12K | |
| Wellness_Programmes.htm | 2024-09-19 00:12 | 12K | |
| Another_Health_Ailment.htm | 2024-09-19 00:12 | 12K | |
| Information_Memorandum.htm | 2024-09-19 00:12 | 12K | |
| YELP_ExceptionalCommunityContributionMedal.htm | 2024-09-19 00:12 | 12K | |
| Initial Two Stages.htm | 2024-09-19 00:12 | 12K | |
| Jogging_RoadRunning_CrossCountryRunning.htm | 2024-09-19 00:12 | 12K | |
| Offer and Request Forms.htm | 2024-09-19 00:12 | 12K | |
| Sole_Voting_Rights.htm | 2024-09-19 00:12 | 12K | |
| CommunityHealthRiskFactorMgtResearchProject-NSW.htm | 2024-09-19 00:12 | 12K | |
| HeadConsultForThreeNatPreHealthResearchPrograms.htm | 2024-09-19 00:12 | 12K | |
| CommunitySupportProvider.htm | 2024-09-19 00:12 | 12K | |
| GP's Patient.htm | 2024-09-19 00:12 | 12K | |
| Kayaking&Canoeing.htm | 2024-09-19 00:12 | 12K | |
| LapSwimming_up_to_400_metres.htm | 2024-09-19 00:12 | 12K | |
| Primary Prevention.htm | 2024-09-19 00:12 | 12K | |
| Complimentary_Employee_Enthusiasm.htm | 2024-09-19 00:12 | 12K | |
| Duration_Of_Life.htm | 2024-09-19 00:12 | 12K | |
| Dept of Climate Change.htm | 2024-09-19 00:12 | 12K | |
| SelectedDistrictRecreationalCycleGroups.htm | 2024-09-19 00:12 | 12K | |
| Sporting_Team_Organiser.htm | 2024-09-19 00:12 | 12K | |
| FivePriorityAreasForAustralianBetterHealthInitiative.htm | 2024-09-19 00:12 | 12K | |
| Lap_Swimming_beyond_400m.htm | 2024-09-19 00:12 | 12K | |
| Sedentary Leisure Activities.htm | 2024-09-19 00:12 | 12K | |
| FiveGuidanceInfluences.htm | 2024-09-19 00:12 | 12K | |
| Core_Product.htm | 2024-09-19 00:12 | 12K | |
| CommunityDrivenCommunityBuildingProgram.htm | 2024-09-19 00:12 | 12K | |
| Conspicuous_Consumption.htm | 2024-09-19 00:12 | 12K | |
| youthful_exuberance.htm | 2024-09-19 00:12 | 12K | |
| Personal_Carbon_Footprint.htm | 2024-09-19 00:12 | 12K | |
| Exercise Alone.htm | 2024-09-19 00:12 | 12K | |
| Acquires_Theoretical_Knowledge.htm | 2024-09-19 00:12 | 12K | |
| Triathlon.htm | 2024-09-19 00:12 | 12K | |
| Primary_Care.htm | 2024-09-19 00:12 | 12K | |
| 2nd_Legendary_Endurance_Cycling_Challenge.htm | 2024-09-19 00:12 | 12K | |
| Primary_Energy_Carbon_Contributors.htm | 2024-09-19 00:12 | 11K | |
| Refer.htm | 2024-09-19 00:12 | 11K | |
| Walking_Up_To_5_Kilometres.htm | 2024-09-19 00:12 | 11K | |
| Average_Australian'sTargetCarbonFootprint.htm | 2024-09-19 00:12 | 11K | |
| Physical�Challenges CV.htm | 2024-09-19 00:12 | 11K | |
| Talk The Walk Motivational Skills.htm | 2024-09-19 00:12 | 11K | |
| Systemic_Lupus_Erythematosus.htm | 2024-09-19 00:12 | 11K | |
| Economic_Materialism.htm | 2024-09-19 00:12 | 11K | |
| Hankering_For_Beneficial_Stress_Release.htm | 2024-09-19 00:12 | 11K | |
| InterestedAdultPersonalProfile.htm | 2024-09-19 00:12 | 11K | |
| Environment, Heritage and Arts.htm | 2024-09-19 00:12 | 11K | |
| social_theme.htm | 2024-09-19 00:12 | 11K | |
| Critical_Mass.htm | 2024-09-19 00:12 | 11K | |
| Adult_Enquirer.htm | 2024-09-19 00:12 | 11K | |
| Dept of Health & Ageing.htm | 2024-09-19 00:12 | 11K | |
| Organiser.htm | 2024-09-19 00:12 | 11K | |
| Brand_Name.htm | 2024-09-19 00:12 | 11K | |
| Introduce.htm | 2024-09-19 00:12 | 11K | |
| Case Study-Team_ Nova-2007_Boston_Marathon.htm | 2024-09-19 00:12 | 11K | |
| Individual�Carbon Taxes.htm | 2024-09-19 00:12 | 11K | |
| Operational Risk.htm | 2024-09-19 00:12 | 11K | |
| TwoDeal-BreakerPurposesOfPrimaryResearchProgram.htm | 2024-09-19 00:12 | 11K | |
| GHGs.htm | 2024-09-19 00:12 | 11K | |
| Local_District_Recreational_Exercise_Group.htm | 2024-09-19 00:12 | 11K | |
| Earth's_Atmosphere.htm | 2024-09-19 00:12 | 11K | |
| Specific Industry�Group.htm | 2024-09-19 00:12 | 11K | |
| VO2.htm | 2024-09-19 00:12 | 11K | |
| Government.htm | 2024-09-19 00:12 | 11K | |
| Eleven Segments.htm | 2024-09-19 00:12 | 11K | |
| RecLinkAustralia.htm | 2024-09-19 00:12 | 11K | |
| Greenfield.htm | 2024-09-19 00:12 | 11K | |
| reduce_carbon_emissions.htm | 2024-09-19 00:12 | 11K | |
| Supervise.htm | 2024-09-19 00:12 | 11K | |
| LocalDistrictModerateRecreationalExerciseGroup.htm | 2024-09-19 00:12 | 11K | |
| Personal_Health_And_Fitness.htm | 2024-09-19 00:12 | 11K | |
| DIISR.htm | 2024-09-19 00:12 | 11K | |
| Substance_Abuse.htm | 2024-09-19 00:12 | 11K | |
| Positive Lifestyle Changes.htm | 2024-09-19 00:12 | 11K | |
| First_Business_Plan.htm | 2024-09-19 00:12 | 11K | |
| Brownfield.htm | 2024-09-19 00:12 | 11K | |
| Disabilities.htm | 2024-09-19 00:12 | 11K | |
| Prototype.htm | 2024-09-19 00:12 | 11K | |
| Team Structure.htm | 2024-09-19 00:12 | 11K | |
| 1st_Legendary_Endurance_Cycling_Challenge.htm | 2024-09-19 00:12 | 11K | |
| Survey�Period.htm | 2024-09-19 00:12 | 11K | |
| Neo-Liberals.htm | 2024-09-19 00:12 | 11K | |
| Defined_Terms_For_YELP's_Five_Business_Plans.htm | 2024-09-19 00:12 | 11K | |
| Narrow The Generation�Gap.htm | 2024-09-19 00:12 | 11K | |
| Type_1_Diabetes.htm | 2024-09-19 00:12 | 11K | |
| Reduce_Supplementary_Patient_Guidance_Roles.htm | 2024-09-19 00:12 | 11K | |
| SPV.htm | 2024-09-19 00:12 | 11K | |
| youthful_exuberance_growth_phase.htm | 2024-09-19 00:12 | 10K | |
| Passive_Leisure_Activities.htm | 2024-09-19 00:12 | 10K | |
| TwoTraditionalEconomicInfluences.htm | 2024-09-19 00:12 | 10K | |
| carbon_capture_and_storage_or_cc.htm | 2024-09-19 00:12 | 10K | |
| Nurses.htm | 2024-09-19 00:12 | 10K | |
| Invitation Letter.htm | 2024-09-19 00:12 | 10K | |
| PrimaryResearchProgrammeForecastResults.htm | 2024-09-19 00:12 | 10K | |
| Hypertension.htm | 2024-09-19 00:12 | 10K | |
| Escalating�Fallout.htm | 2024-09-19 00:12 | 10K | |
| RecreationalExerciseActivity.htm | 2024-09-19 00:12 | 10K | |
| Third World Countries.htm | 2024-09-19 00:12 | 10K | |
| DonationToYELPDisabledEquipmentFund.htm | 2024-09-19 00:12 | 10K | |
| Cycling.htm | 2024-09-19 00:12 | 10K | |
| research_programme_budget.htm | 2024-09-19 00:12 | 10K | |
| Core_Activity_Restriction.htm | 2024-09-19 00:12 | 10K | |
| Interested Parties Agreed Business Plan.htm | 2024-09-19 00:12 | 10K | |
| Five_Chronic Disease.htm | 2024-09-19 00:12 | 10K | |
| support_groups.htm | 2024-09-19 00:12 | 10K | |
| NursesWanted.htm | 2024-09-19 00:12 | 10K | |
| Administrative_Role.htm | 2024-09-19 00:12 | 10K | |
| Sporting Team Name.htm | 2024-09-19 00:12 | 10K | |
| Implementation_Strategy.htm | 2024-09-19 00:12 | 10K | |
| Training�Module.htm | 2024-09-19 00:12 | 10K | |
| Second World Countries.htm | 2024-09-19 00:12 | 10K | |
| Cognitive_Development.htm | 2024-09-19 00:12 | 10K | |
| Athletes With Asthma.htm | 2024-09-19 00:12 | 10K | |
| Interested_Adult_Application_Form.htm | 2024-09-19 00:12 | 10K | |
| Phase.htm | 2024-09-19 00:12 | 10K | |
| Generation�Gap.htm | 2024-09-19 00:12 | 10K | |
| Administer.htm | 2024-09-19 00:12 | 10K | |
| Funding for NOVA.htm | 2024-09-19 00:12 | 10K | |
| Useful_Information_&_Logistics.htm | 2024-09-19 00:12 | 9.9K | |
| Interested Adult.htm | 2024-09-19 00:12 | 9.9K | |
| Two_Purposes_Of_YELP_SPV.htm | 2024-09-19 00:12 | 9.9K | |
| FiveLifestyleRiskFactorsForChronicDisease.htm | 2024-09-19 00:12 | 9.9K | |
| PBS.htm | 2024-09-19 00:12 | 9.9K | |
| Gout.htm | 2024-09-19 00:12 | 9.9K | |
| performance_benchmarks.htm | 2024-09-19 00:12 | 9.8K | |
| Tertiary Prevention.htm | 2024-09-19 00:12 | 9.7K | |
| CoreActivityRestrictions.htm | 2024-09-19 00:12 | 9.7K | |
| Net Head Consultant Remuneration.htm | 2024-09-19 00:12 | 9.7K | |
| Overweight.htm | 2024-09-19 00:12 | 9.7K | |
| SeriousSportingAccident.htm | 2024-09-19 00:12 | 9.7K | |
| Pilot�Goals, Forecasts and Predictions.htm | 2024-09-19 00:12 | 9.7K | |
| Body_Mass_Index.htm | 2024-09-19 00:12 | 9.7K | |
| General_Practitioner.htm | 2024-09-19 00:12 | 9.7K | |
| Net REC Remuneration.htm | 2024-09-19 00:12 | 9.7K | |
| Corporate_Social_Responsibility.htm | 2024-09-19 00:12 | 9.7K | |
| Healthy Food.htm | 2024-09-19 00:12 | 9.7K | |
| Incidental_Exercise.htm | 2024-09-19 00:12 | 9.6K | |
| SWOT_Analysis_def.htm | 2024-09-19 00:12 | 9.6K | |
| Mild�Limitation.htm | 2024-09-19 00:12 | 9.6K | |
| CopingSkills.htm | 2024-09-19 00:12 | 9.6K | |
| Gen_Y.htm | 2024-09-19 00:12 | 9.6K | |
| Rankings.htm | 2024-09-19 00:12 | 9.6K | |
| Western_world.htm | 2024-09-19 00:12 | 9.5K | |
| Moderate_Limitation.htm | 2024-09-19 00:12 | 9.5K | |
| Secondary Prevention.htm | 2024-09-19 00:12 | 9.5K | |
| Section Titles.htm | 2024-09-19 00:12 | 9.5K | |
| Craving_Negative_Stress��_Releases.htm | 2024-09-19 00:12 | 9.5K | |
| Cognitive_Skills.htm | 2024-09-19 00:12 | 9.5K | |
| Emotional Eating.htm | 2024-09-19 00:12 | 9.5K | |
| Gestational_Diabetes.htm | 2024-09-19 00:12 | 9.5K | |
| Baby_Boomer.htm | 2024-09-19 00:12 | 9.5K | |
| Leisure Time Availability.htm | 2024-09-19 00:12 | 9.5K | |
| FourTraditionalAvailableRigorousRecreationalActivities.htm | 2024-09-19 00:12 | 9.4K | |
| $50billionAnnualSocialCostofDrugAbuseinAust.htm | 2024-09-19 00:12 | 9.4K | |
| Aust_Nat_Physical_Activity_Ex_Guidelines.htm | 2024-09-19 00:12 | 9.4K | |
| FiveMajorReligions.htm | 2024-09-19 00:12 | 9.4K | |
| HeadConsultant'sMonthlyReportToEquityHolders.htm | 2024-09-19 00:12 | 9.4K | |
| authors.htm | 2024-09-19 00:12 | 9.4K | |
| 100_point_test.htm | 2024-09-19 00:12 | 9.3K | |
| Accreditation_Benchmarks.htm | 2024-09-19 00:12 | 9.3K | |
| First World Countries.htm | 2024-09-19 00:12 | 9.3K | |
| Chronic_Disability.htm | 2024-09-19 00:12 | 9.2K | |
| BurgeoningBabyBoomerFiscalCosts.htm | 2024-09-19 00:12 | 9.2K | |
| CarbonReductionInducements.htm | 2024-09-19 00:12 | 9.2K | |
| Ecologically_Sustainable_Development.htm | 2024-09-19 00:12 | 9.2K | |
| Gen_X.htm | 2024-09-19 00:12 | 9.1K | |
| Demographic.htm | 2024-09-19 00:12 | 9.1K | |
| Core_Activities.htm | 2024-09-19 00:12 | 9.1K | |
| ConditionsPrecedenttoPropagation.htm | 2024-09-19 00:12 | 9.1K | |
| Greenhouse Effect.htm | 2024-09-19 00:12 | 9.0K | |
| Dedication,DisciplineAndCommitment.htm | 2024-09-19 00:12 | 9.0K | |
| ArduousEnduranceSportingEvents.htm | 2024-09-19 00:12 | 9.0K | |
| Family Unit Cohesion.htm | 2024-09-19 00:12 | 8.9K | |
| Global_Warming.htm | 2024-09-19 00:12 | 8.7K | |
| Stages.jpg | 2011-04-23 05:56 | 8.5K | |
| Revised Invitation Letter.htm | 2024-09-19 00:12 | 5.3K | |
| Collective_Action.htm | 2024-09-19 00:12 | 4.8K | |
| Disadvantaged.htm | 2024-09-19 00:12 | 4.4K | |
| mumandchild2.jpg | 2009-01-29 07:14 | 3.0K | |
| More_conspicuous_consumption.htm | 2024-09-19 00:12 | 2.4K | |
| inactive_r.modern.gif | 2008-07-21 07:51 | 350 | |
| trans.gif | 2009-01-29 07:14 | 93 | |
| inactive_a.modern.flex.gif | 2008-07-21 07:51 | 80 | |
| 5bstoc.bmp | 2011-04-23 06:00 | 58 | |
| inactive_s.modern.gif | 2008-07-21 07:51 | 54 | |
| inactive_m.modern.gif | 2008-07-21 07:51 | 44 | |
| editarea.css | 2008-12-28 23:30 | 34 | |
![[DIR]](/icons/folder.gif) | _vti_cnf/ | 2024-09-24 06:59 | - | |
| _derived/ | 2024-09-24 06:41 | - | |
| TaskforceReportToMinister/ | 2024-09-24 06:26 | - | |
| RM/ | 2024-09-24 06:25 | - | |
| R&DTimeBudgetCostsToPropagateThreeBusinessPlans_files/ | 2024-09-24 06:23 | - | |
| QuantifyEconReturnYELPCapex/ | 2024-09-24 06:23 | - | |
| PreparatoryRP/ | 2024-09-24 06:16 | - | |
| ImformationMemo/ | 2024-09-24 06:15 | - | |
|
|---|
